About N,N,N',N'-tetrabutylhexanediamide
N,N,N',N'-tetrabutylhexanediamide (PubChem CID 2933474) has the molecular formula C22H44N2O2
and a molecular weight of 368.61 g/mol. Its IUPAC name is N,N,N',N'-tetrabutylhexanediamide.
Molecular Properties
| Compound Name | N,N,N',N'-tetrabutylhexanediamide |
| PubChem CID | 2933474 |
| Molecular Formula | C22H44N2O2 |
| Molecular Weight | 368.61 g/mol |
| Exact Mass | 368.34 |
| IUPAC Name | N,N,N',N'-tetrabutylhexanediamide |
| SMILES | CCCCN(CCCC)C(=O)CCCCC(=O)N(CCCC)CCCC |
| InChI | InChI=1S/C22H44N2O2/c1-5-9-17-23(18-10-6-2)21(25)15-13-14-16-22(26)24(19-11-7-3)20-12-8-4/h5-20H2,1-4H3 |
| InChIKey | QVQZFDVPVBBFAT-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.61 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N,N',N'-tetrabutylhexanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N,N',N'-tetrabutylhexanediamide?
The IUPAC name of N,N,N',N'-tetrabutylhexanediamide (CID 2933474) is N,N,N',N'-tetrabutylhexanediamide.
What is the SMILES notation for N,N,N',N'-tetrabutylhexanediamide?
The canonical SMILES for N,N,N',N'-tetrabutylhexanediamide is CCCCN(CCCC)C(=O)CCCCC(=O)N(CCCC)CCCC.
What is the InChIKey of N,N,N',N'-tetrabutylhexanediamide?
The InChIKey is QVQZFDVPVBBFAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H44N2O2/c1-5-9-17-23(18-10-6-2)21(25)15-13-14-16-22(26)24(19-11-7-3)20-12-8-4/h5-20H2,1-4H3.
What are the key properties of N,N,N',N'-tetrabutylhexanediamide?
N,N,N',N'-tetrabutylhexanediamide has a molecular weight of 368.61 g/mol, XLogP of 5.40, 17 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N,N',N'-tetrabutylhexanediamide is sourced from PubChem (CID 2933474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).