C16H17IN4OS — CID 29336472
2-[(5-cyclopropyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-iodophenyl)acetamide (PubChem CID 29336472) has the molecular formula C16H17IN4OS and a molecular weight of 440.31 g/mol. Its IUPAC name is 2-[(5-cyclopropyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-iodophenyl)acetamide.
| Compound Name | 2-[(5-cyclopropyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-iodophenyl)acetamide |
|---|---|
| PubChem CID | 29336472 |
| Molecular Formula | C16H17IN4OS |
| Molecular Weight | 440.31 g/mol |
| Exact Mass | 440.02 |
| IUPAC Name | 2-[(5-cyclopropyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-iodophenyl)acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cccc(I)c2)nnc1C1CC1 |
| InChI | InChI=1S/C16H17IN4OS/c1-2-8-21-15(11-6-7-11)19-20-16(21)23-10-14(22)18-13-5-3-4-12(17)9-13/h2-5,9,11H,1,6-8,10H2,(H,18,22) |
| InChIKey | QBQPNTXKIODYPN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|