C27H29F3N2O3 — CID 29336691
(2R,3R)-1-butyl-2-(2-methoxyphenyl)-6-oxo-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]piperidine-3-carboxamide (PubChem CID 29336691) has the molecular formula C27H29F3N2O3 and a molecular weight of 486.53 g/mol. Its IUPAC name is (2R,3R)-1-butyl-2-(2-methoxyphenyl)-6-oxo-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]piperidine-3-carboxamide.
| Compound Name | (2R,3R)-1-butyl-2-(2-methoxyphenyl)-6-oxo-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 29336691 |
| Molecular Formula | C27H29F3N2O3 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | (2R,3R)-1-butyl-2-(2-methoxyphenyl)-6-oxo-N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]piperidine-3-carboxamide |
| SMILES | CCCCN1C(=O)CC[C@@H](C(=O)NCC#Cc2cccc(C(F)(F)F)c2)[C@@H]1c1ccccc1OC |
| InChI | InChI=1S/C27H29F3N2O3/c1-3-4-17-32-24(33)15-14-22(25(32)21-12-5-6-13-23(21)35-2)26(34)31-16-8-10-19-9-7-11-20(18-19)27(28,29)30/h5-7,9,11-13,18,22,25H,3-4,14-17H2,1-2H3,(H,31,34)/t22-,25+/m1/s1 |
| InChIKey | IOZBPYASKSZNSB-RDGATRHJSA-N |
| XLogP | 4.96 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|