C16H13FIN5OS — CID 29338121
2-[[4-amino-5-(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-iodophenyl)acetamide (PubChem CID 29338121) has the molecular formula C16H13FIN5OS and a molecular weight of 469.28 g/mol. Its IUPAC name is 2-[[4-amino-5-(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-iodophenyl)acetamide.
| Compound Name | 2-[[4-amino-5-(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-iodophenyl)acetamide |
|---|---|
| PubChem CID | 29338121 |
| Molecular Formula | C16H13FIN5OS |
| Molecular Weight | 469.28 g/mol |
| Exact Mass | 468.99 |
| IUPAC Name | 2-[[4-amino-5-(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-iodophenyl)acetamide |
| SMILES | Nn1c(SCC(=O)Nc2cccc(I)c2)nnc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C16H13FIN5OS/c17-11-6-4-10(5-7-11)15-21-22-16(23(15)19)25-9-14(24)20-13-3-1-2-12(18)8-13/h1-8H,9,19H2,(H,20,24) |
| InChIKey | QJKXZDKNAOFZSJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|