2-(3-chlorophenoxy)-N,N-dimethylethanamine;oxalic acid

C12H16ClNO5 — CID 2934029

IUPAC2-(3-chlorophenoxy)-N,N-dimethylethanamine;oxalic acid
SMILESCN(C)CCOc1cccc(Cl)c1.O=C(O)C(=O)O
InChIInChI=1S/C10H14ClNO.C2H2O4/c1-12(2)6-7-13-10-5-3-4-9(11)8-10;3-1(4)2(5)6/h3-5,8H,6-7H2,1-2H3;(H,3,4)(H,5,6)
InChIKeyKKWFOFPQMZFSME-UHFFFAOYSA-N
MW289.71 g/mol
LogP1.44
Rot. Bonds4

About 2-(3-chlorophenoxy)-N,N-dimethylethanamine;oxalic acid

2-(3-chlorophenoxy)-N,N-dimethylethanamine;oxalic acid (PubChem CID 2934029) has the molecular formula C12H16ClNO5 and a molecular weight of 289.71 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-N,N-dimethylethanamine;oxalic acid.

Molecular Properties

Compound Name2-(3-chlorophenoxy)-N,N-dimethylethanamine;oxalic acid
PubChem CID2934029
Molecular FormulaC12H16ClNO5
Molecular Weight289.71 g/mol
Exact Mass289.07
IUPAC Name2-(3-chlorophenoxy)-N,N-dimethylethanamine;oxalic acid
SMILESCN(C)CCOc1cccc(Cl)c1.O=C(O)C(=O)O
InChIInChI=1S/C10H14ClNO.C2H2O4/c1-12(2)6-7-13-10-5-3-4-9(11)8-10;3-1(4)2(5)6/h3-5,8H,6-7H2,1-2H3;(H,3,4)(H,5,6)
InChIKeyKKWFOFPQMZFSME-UHFFFAOYSA-N
XLogP1.44
TPSA87.07 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.71
LogP ≤ 51.44
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 2-(3-chlorophenoxy)-N,N-dimethylethanamine;oxalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-chlorophenoxy)-N,N-dimethylethanamine;oxalic acid?
The IUPAC name of 2-(3-chlorophenoxy)-N,N-dimethylethanamine;oxalic acid (CID 2934029) is 2-(3-chlorophenoxy)-N,N-dimethylethanamine;oxalic acid.
What is the SMILES notation for 2-(3-chlorophenoxy)-N,N-dimethylethanamine;oxalic acid?
The canonical SMILES for 2-(3-chlorophenoxy)-N,N-dimethylethanamine;oxalic acid is CN(C)CCOc1cccc(Cl)c1.O=C(O)C(=O)O.
What is the InChIKey of 2-(3-chlorophenoxy)-N,N-dimethylethanamine;oxalic acid?
The InChIKey is KKWFOFPQMZFSME-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClNO.C2H2O4/c1-12(2)6-7-13-10-5-3-4-9(11)8-10;3-1(4)2(5)6/h3-5,8H,6-7H2,1-2H3;(H,3,4)(H,5,6).
What are the key properties of 2-(3-chlorophenoxy)-N,N-dimethylethanamine;oxalic acid?
2-(3-chlorophenoxy)-N,N-dimethylethanamine;oxalic acid has a molecular weight of 289.71 g/mol, XLogP of 1.44, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chlorophenoxy)-N,N-dimethylethanamine;oxalic acid is sourced from PubChem (CID 2934029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).