C21H33NO7 — CID 2934356
2,6-dimethyl-4-[2-[2-(2,3,6-trimethylphenoxy)ethoxy]ethyl]morpholine;oxalic acid (PubChem CID 2934356) has the molecular formula C21H33NO7 and a molecular weight of 411.50 g/mol. Its IUPAC name is 2,6-dimethyl-4-[2-[2-(2,3,6-trimethylphenoxy)ethoxy]ethyl]morpholine;oxalic acid.
| Compound Name | 2,6-dimethyl-4-[2-[2-(2,3,6-trimethylphenoxy)ethoxy]ethyl]morpholine;oxalic acid |
|---|---|
| PubChem CID | 2934356 |
| Molecular Formula | C21H33NO7 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 2,6-dimethyl-4-[2-[2-(2,3,6-trimethylphenoxy)ethoxy]ethyl]morpholine;oxalic acid |
| SMILES | Cc1ccc(C)c(OCCOCCN2CC(C)OC(C)C2)c1C.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H31NO3.C2H2O4/c1-14-6-7-15(2)19(18(14)5)22-11-10-21-9-8-20-12-16(3)23-17(4)13-20;3-1(4)2(5)6/h6-7,16-17H,8-13H2,1-5H3;(H,3,4)(H,5,6) |
| InChIKey | NGPGDWIFIDAPKH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|