C17H23Cl2NO5 — CID 2934364
1-[2-(2,4-dichlorophenoxy)ethyl]-3,5-dimethylpiperidine;oxalic acid (PubChem CID 2934364) has the molecular formula C17H23Cl2NO5 and a molecular weight of 392.28 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenoxy)ethyl]-3,5-dimethylpiperidine;oxalic acid.
| Compound Name | 1-[2-(2,4-dichlorophenoxy)ethyl]-3,5-dimethylpiperidine;oxalic acid |
|---|---|
| PubChem CID | 2934364 |
| Molecular Formula | C17H23Cl2NO5 |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 1-[2-(2,4-dichlorophenoxy)ethyl]-3,5-dimethylpiperidine;oxalic acid |
| SMILES | CC1CC(C)CN(CCOc2ccc(Cl)cc2Cl)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H21Cl2NO.C2H2O4/c1-11-7-12(2)10-18(9-11)5-6-19-15-4-3-13(16)8-14(15)17;3-1(4)2(5)6/h3-4,8,11-12H,5-7,9-10H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | XNOPOGPMISIGRD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|