C20H33N5O2 — CID 29344076
N'-cyclohexyl-N-[(2R)-2-(4-methylpiperazin-1-yl)-2-(1-methylpyrrol-2-yl)ethyl]oxamide (PubChem CID 29344076) has the molecular formula C20H33N5O2 and a molecular weight of 375.52 g/mol. Its IUPAC name is N'-cyclohexyl-N-[(2R)-2-(4-methylpiperazin-1-yl)-2-(1-methylpyrrol-2-yl)ethyl]oxamide.
| Compound Name | N'-cyclohexyl-N-[(2R)-2-(4-methylpiperazin-1-yl)-2-(1-methylpyrrol-2-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 29344076 |
| Molecular Formula | C20H33N5O2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | N'-cyclohexyl-N-[(2R)-2-(4-methylpiperazin-1-yl)-2-(1-methylpyrrol-2-yl)ethyl]oxamide |
| SMILES | CN1CCN([C@H](CNC(=O)C(=O)NC2CCCCC2)c2cccn2C)CC1 |
| InChI | InChI=1S/C20H33N5O2/c1-23-11-13-25(14-12-23)18(17-9-6-10-24(17)2)15-21-19(26)20(27)22-16-7-4-3-5-8-16/h6,9-10,16,18H,3-5,7-8,11-15H2,1-2H3,(H,21,26)(H,22,27)/t18-/m1/s1 |
| InChIKey | CUBVCERUDCKMMF-GOSISDBHSA-N |
| XLogP | 0.88 |
| TPSA | 69.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|