C21H17N3O — CID 2935184
5-(2,2-diphenylethyl)-3-pyridin-2-yl-1,2,4-oxadiazole (PubChem CID 2935184) has the molecular formula C21H17N3O and a molecular weight of 327.39 g/mol. Its IUPAC name is 5-(2,2-diphenylethyl)-3-pyridin-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-(2,2-diphenylethyl)-3-pyridin-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 2935184 |
| Molecular Formula | C21H17N3O |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 5-(2,2-diphenylethyl)-3-pyridin-2-yl-1,2,4-oxadiazole |
| SMILES | c1ccc(C(Cc2nc(-c3ccccn3)no2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H17N3O/c1-3-9-16(10-4-1)18(17-11-5-2-6-12-17)15-20-23-21(24-25-20)19-13-7-8-14-22-19/h1-14,18H,15H2 |
| InChIKey | WACXPWUMJWKXLJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |