About 4-propoxyphenol
4-propoxyphenol (PubChem CID 29352) has the molecular formula C9H12O2
and a molecular weight of 152.19 g/mol. Its IUPAC name is 4-propoxyphenol.
Molecular Properties
| Compound Name | 4-propoxyphenol |
| PubChem CID | 29352 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 4-propoxyphenol |
| SMILES | CCCOc1ccc(O)cc1 |
| InChI | InChI=1S/C9H12O2/c1-2-7-11-9-5-3-8(10)4-6-9/h3-6,10H,2,7H2,1H3 |
| InChIKey | KIIIPQXXLVCCQP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-propoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propoxyphenol?
The IUPAC name of 4-propoxyphenol (CID 29352) is 4-propoxyphenol.
What is the SMILES notation for 4-propoxyphenol?
The canonical SMILES for 4-propoxyphenol is CCCOc1ccc(O)cc1.
What is the InChIKey of 4-propoxyphenol?
The InChIKey is KIIIPQXXLVCCQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2/c1-2-7-11-9-5-3-8(10)4-6-9/h3-6,10H,2,7H2,1H3.
What are the key properties of 4-propoxyphenol?
4-propoxyphenol has a molecular weight of 152.19 g/mol, XLogP of 2.18, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propoxyphenol is sourced from PubChem (CID 29352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).