About N-benzyl-3-(2-fluorophenoxy)-N-methylpropan-1-amine;oxalic acid
N-benzyl-3-(2-fluorophenoxy)-N-methylpropan-1-amine;oxalic acid (PubChem CID 2935264) has the molecular formula C19H22FNO5
and a molecular weight of 363.39 g/mol. Its IUPAC name is N-benzyl-3-(2-fluorophenoxy)-N-methylpropan-1-amine;oxalic acid.
Molecular Properties
| Compound Name | N-benzyl-3-(2-fluorophenoxy)-N-methylpropan-1-amine;oxalic acid |
| PubChem CID | 2935264 |
| Molecular Formula | C19H22FNO5 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | N-benzyl-3-(2-fluorophenoxy)-N-methylpropan-1-amine;oxalic acid |
| SMILES | CN(CCCOc1ccccc1F)Cc1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H20FNO.C2H2O4/c1-19(14-15-8-3-2-4-9-15)12-7-13-20-17-11-6-5-10-16(17)18;3-1(4)2(5)6/h2-6,8-11H,7,12-14H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | QRMKNAHVZUNQBR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-3-(2-fluorophenoxy)-N-methylpropan-1-amine;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-3-(2-fluorophenoxy)-N-methylpropan-1-amine;oxalic acid?
The IUPAC name of N-benzyl-3-(2-fluorophenoxy)-N-methylpropan-1-amine;oxalic acid (CID 2935264) is N-benzyl-3-(2-fluorophenoxy)-N-methylpropan-1-amine;oxalic acid.
What is the SMILES notation for N-benzyl-3-(2-fluorophenoxy)-N-methylpropan-1-amine;oxalic acid?
The canonical SMILES for N-benzyl-3-(2-fluorophenoxy)-N-methylpropan-1-amine;oxalic acid is CN(CCCOc1ccccc1F)Cc1ccccc1.O=C(O)C(=O)O.
What is the InChIKey of N-benzyl-3-(2-fluorophenoxy)-N-methylpropan-1-amine;oxalic acid?
The InChIKey is QRMKNAHVZUNQBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20FNO.C2H2O4/c1-19(14-15-8-3-2-4-9-15)12-7-13-20-17-11-6-5-10-16(17)18;3-1(4)2(5)6/h2-6,8-11H,7,12-14H2,1H3;(H,3,4)(H,5,6).
What are the key properties of N-benzyl-3-(2-fluorophenoxy)-N-methylpropan-1-amine;oxalic acid?
N-benzyl-3-(2-fluorophenoxy)-N-methylpropan-1-amine;oxalic acid has a molecular weight of 363.39 g/mol, XLogP of 2.88, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-3-(2-fluorophenoxy)-N-methylpropan-1-amine;oxalic acid is sourced from PubChem (CID 2935264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).