About 4-pentoxyphenol
4-pentoxyphenol (PubChem CID 29353) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is 4-pentoxyphenol.
Molecular Properties
| Compound Name | 4-pentoxyphenol |
| PubChem CID | 29353 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 4-pentoxyphenol |
| SMILES | CCCCCOc1ccc(O)cc1 |
| InChI | InChI=1S/C11H16O2/c1-2-3-4-9-13-11-7-5-10(12)6-8-11/h5-8,12H,2-4,9H2,1H3 |
| InChIKey | JCLFHZLOKITRCE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-pentoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pentoxyphenol?
The IUPAC name of 4-pentoxyphenol (CID 29353) is 4-pentoxyphenol.
What is the SMILES notation for 4-pentoxyphenol?
The canonical SMILES for 4-pentoxyphenol is CCCCCOc1ccc(O)cc1.
What is the InChIKey of 4-pentoxyphenol?
The InChIKey is JCLFHZLOKITRCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2/c1-2-3-4-9-13-11-7-5-10(12)6-8-11/h5-8,12H,2-4,9H2,1H3.
What are the key properties of 4-pentoxyphenol?
4-pentoxyphenol has a molecular weight of 180.25 g/mol, XLogP of 2.96, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pentoxyphenol is sourced from PubChem (CID 29353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).