About 4-hexoxyphenol
4-hexoxyphenol (PubChem CID 29354) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is 4-hexoxyphenol.
Molecular Properties
| Compound Name | 4-hexoxyphenol |
| PubChem CID | 29354 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 4-hexoxyphenol |
| SMILES | CCCCCCOc1ccc(O)cc1 |
| InChI | InChI=1S/C12H18O2/c1-2-3-4-5-10-14-12-8-6-11(13)7-9-12/h6-9,13H,2-5,10H2,1H3 |
| InChIKey | XIIIHRLCKLSYNH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-hexoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hexoxyphenol?
The IUPAC name of 4-hexoxyphenol (CID 29354) is 4-hexoxyphenol.
What is the SMILES notation for 4-hexoxyphenol?
The canonical SMILES for 4-hexoxyphenol is CCCCCCOc1ccc(O)cc1.
What is the InChIKey of 4-hexoxyphenol?
The InChIKey is XIIIHRLCKLSYNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2/c1-2-3-4-5-10-14-12-8-6-11(13)7-9-12/h6-9,13H,2-5,10H2,1H3.
What are the key properties of 4-hexoxyphenol?
4-hexoxyphenol has a molecular weight of 194.27 g/mol, XLogP of 3.35, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hexoxyphenol is sourced from PubChem (CID 29354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).