C22H25N3O2S — CID 2936271
2-(3,4-dimethylphenyl)imino-3-methyl-4-oxo-N-(2-phenylethyl)-1,3-thiazinane-6-carboxamide (PubChem CID 2936271) has the molecular formula C22H25N3O2S and a molecular weight of 395.53 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)imino-3-methyl-4-oxo-N-(2-phenylethyl)-1,3-thiazinane-6-carboxamide.
| Compound Name | 2-(3,4-dimethylphenyl)imino-3-methyl-4-oxo-N-(2-phenylethyl)-1,3-thiazinane-6-carboxamide |
|---|---|
| PubChem CID | 2936271 |
| Molecular Formula | C22H25N3O2S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 2-(3,4-dimethylphenyl)imino-3-methyl-4-oxo-N-(2-phenylethyl)-1,3-thiazinane-6-carboxamide |
| SMILES | Cc1ccc(/N=C2\SC(C(=O)NCCc3ccccc3)CC(=O)N2C)cc1C |
| InChI | InChI=1S/C22H25N3O2S/c1-15-9-10-18(13-16(15)2)24-22-25(3)20(26)14-19(28-22)21(27)23-12-11-17-7-5-4-6-8-17/h4-10,13,19H,11-12,14H2,1-3H3,(H,23,27)/b24-22- |
| InChIKey | WDKGBNLQMAVIFI-GYHWCHFESA-N |
| XLogP | 3.61 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|