C18H21F3N2O4 — CID 2936393
2-ethoxyethyl 3,4-dimethyl-2-oxo-6-[4-(trifluoromethyl)phenyl]-1,6-dihydropyrimidine-5-carboxylate (PubChem CID 2936393) has the molecular formula C18H21F3N2O4 and a molecular weight of 386.37 g/mol. Its IUPAC name is 2-ethoxyethyl 3,4-dimethyl-2-oxo-6-[4-(trifluoromethyl)phenyl]-1,6-dihydropyrimidine-5-carboxylate.
| Compound Name | 2-ethoxyethyl 3,4-dimethyl-2-oxo-6-[4-(trifluoromethyl)phenyl]-1,6-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 2936393 |
| Molecular Formula | C18H21F3N2O4 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 2-ethoxyethyl 3,4-dimethyl-2-oxo-6-[4-(trifluoromethyl)phenyl]-1,6-dihydropyrimidine-5-carboxylate |
| SMILES | CCOCCOC(=O)C1=C(C)N(C)C(=O)NC1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H21F3N2O4/c1-4-26-9-10-27-16(24)14-11(2)23(3)17(25)22-15(14)12-5-7-13(8-6-12)18(19,20)21/h5-8,15H,4,9-10H2,1-3H3,(H,22,25) |
| InChIKey | NWSMBTBQIADDNF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|