C25H22ClN3O3S — CID 2936486
2-[3-[(2-chlorophenyl)methyl]-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-yl]-N-(2-methoxyphenyl)acetamide (PubChem CID 2936486) has the molecular formula C25H22ClN3O3S and a molecular weight of 479.99 g/mol. Its IUPAC name is 2-[3-[(2-chlorophenyl)methyl]-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-yl]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[3-[(2-chlorophenyl)methyl]-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-yl]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 2936486 |
| Molecular Formula | C25H22ClN3O3S |
| Molecular Weight | 479.99 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | 2-[3-[(2-chlorophenyl)methyl]-5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-yl]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)CC1C(=O)N(c2ccccc2)C(=S)N1Cc1ccccc1Cl |
| InChI | InChI=1S/C25H22ClN3O3S/c1-32-22-14-8-7-13-20(22)27-23(30)15-21-24(31)29(18-10-3-2-4-11-18)25(33)28(21)16-17-9-5-6-12-19(17)26/h2-14,21H,15-16H2,1H3,(H,27,30) |
| InChIKey | FQPVRQZOLDBYQJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.99 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|