About N-(3-chlorophenyl)-3-methyl-2-methylimino-4-oxo-1,3-thiazine-6-carboxamide;hydrobromide
N-(3-chlorophenyl)-3-methyl-2-methylimino-4-oxo-1,3-thiazine-6-carboxamide;hydrobromide (PubChem CID 2936824) has the molecular formula C13H13BrClN3O2S
and a molecular weight of 390.69 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-methyl-2-methylimino-4-oxo-1,3-thiazine-6-carboxamide;hydrobromide.
Molecular Properties
| Compound Name | N-(3-chlorophenyl)-3-methyl-2-methylimino-4-oxo-1,3-thiazine-6-carboxamide;hydrobromide |
| PubChem CID | 2936824 |
| Molecular Formula | C13H13BrClN3O2S |
| Molecular Weight | 390.69 g/mol |
| Exact Mass | 388.96 |
| IUPAC Name | N-(3-chlorophenyl)-3-methyl-2-methylimino-4-oxo-1,3-thiazine-6-carboxamide;hydrobromide |
| SMILES | Br.C/N=c1\sc(C(=O)Nc2cccc(Cl)c2)cc(=O)n1C |
| InChI | InChI=1S/C13H12ClN3O2S.BrH/c1-15-13-17(2)11(18)7-10(20-13)12(19)16-9-5-3-4-8(14)6-9;/h3-7H,1-2H3,(H,16,19);1H/b15-13-; |
| InChIKey | NBNDMMQYBNRSPA-ZDCVYKBASA-N |
| XLogP | 2.46 |
| TPSA | 63.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.69 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3-chlorophenyl)-3-methyl-2-methylimino-4-oxo-1,3-thiazine-6-carboxamide;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chlorophenyl)-3-methyl-2-methylimino-4-oxo-1,3-thiazine-6-carboxamide;hydrobromide?
The IUPAC name of N-(3-chlorophenyl)-3-methyl-2-methylimino-4-oxo-1,3-thiazine-6-carboxamide;hydrobromide (CID 2936824) is N-(3-chlorophenyl)-3-methyl-2-methylimino-4-oxo-1,3-thiazine-6-carboxamide;hydrobromide.
What is the SMILES notation for N-(3-chlorophenyl)-3-methyl-2-methylimino-4-oxo-1,3-thiazine-6-carboxamide;hydrobromide?
The canonical SMILES for N-(3-chlorophenyl)-3-methyl-2-methylimino-4-oxo-1,3-thiazine-6-carboxamide;hydrobromide is Br.C/N=c1\sc(C(=O)Nc2cccc(Cl)c2)cc(=O)n1C.
What is the InChIKey of N-(3-chlorophenyl)-3-methyl-2-methylimino-4-oxo-1,3-thiazine-6-carboxamide;hydrobromide?
The InChIKey is NBNDMMQYBNRSPA-ZDCVYKBASA-N. The full InChI is InChI=1S/C13H12ClN3O2S.BrH/c1-15-13-17(2)11(18)7-10(20-13)12(19)16-9-5-3-4-8(14)6-9;/h3-7H,1-2H3,(H,16,19);1H/b15-13-;.
What are the key properties of N-(3-chlorophenyl)-3-methyl-2-methylimino-4-oxo-1,3-thiazine-6-carboxamide;hydrobromide?
N-(3-chlorophenyl)-3-methyl-2-methylimino-4-oxo-1,3-thiazine-6-carboxamide;hydrobromide has a molecular weight of 390.69 g/mol, XLogP of 2.46, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chlorophenyl)-3-methyl-2-methylimino-4-oxo-1,3-thiazine-6-carboxamide;hydrobromide is sourced from PubChem (CID 2936824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).