About 4-tert-butyl-N-(1,3,4-thiadiazol-2-yl)cyclohexane-1-carboxamide
4-tert-butyl-N-(1,3,4-thiadiazol-2-yl)cyclohexane-1-carboxamide (PubChem CID 29369750) has the molecular formula C13H21N3OS
and a molecular weight of 267.40 g/mol. Its IUPAC name is 4-tert-butyl-N-(1,3,4-thiadiazol-2-yl)cyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | 4-tert-butyl-N-(1,3,4-thiadiazol-2-yl)cyclohexane-1-carboxamide |
| PubChem CID | 29369750 |
| Molecular Formula | C13H21N3OS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 4-tert-butyl-N-(1,3,4-thiadiazol-2-yl)cyclohexane-1-carboxamide |
| SMILES | CC(C)(C)C1CCC(C(=O)Nc2nncs2)CC1 |
| InChI | InChI=1S/C13H21N3OS/c1-13(2,3)10-6-4-9(5-7-10)11(17)15-12-16-14-8-18-12/h8-10H,4-7H2,1-3H3,(H,15,16,17) |
| InChIKey | FLDRWJNSISFLGF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-tert-butyl-N-(1,3,4-thiadiazol-2-yl)cyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-N-(1,3,4-thiadiazol-2-yl)cyclohexane-1-carboxamide?
The IUPAC name of 4-tert-butyl-N-(1,3,4-thiadiazol-2-yl)cyclohexane-1-carboxamide (CID 29369750) is 4-tert-butyl-N-(1,3,4-thiadiazol-2-yl)cyclohexane-1-carboxamide.
What is the SMILES notation for 4-tert-butyl-N-(1,3,4-thiadiazol-2-yl)cyclohexane-1-carboxamide?
The canonical SMILES for 4-tert-butyl-N-(1,3,4-thiadiazol-2-yl)cyclohexane-1-carboxamide is CC(C)(C)C1CCC(C(=O)Nc2nncs2)CC1.
What is the InChIKey of 4-tert-butyl-N-(1,3,4-thiadiazol-2-yl)cyclohexane-1-carboxamide?
The InChIKey is FLDRWJNSISFLGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3OS/c1-13(2,3)10-6-4-9(5-7-10)11(17)15-12-16-14-8-18-12/h8-10H,4-7H2,1-3H3,(H,15,16,17).
What are the key properties of 4-tert-butyl-N-(1,3,4-thiadiazol-2-yl)cyclohexane-1-carboxamide?
4-tert-butyl-N-(1,3,4-thiadiazol-2-yl)cyclohexane-1-carboxamide has a molecular weight of 267.40 g/mol, XLogP of 3.33, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-N-(1,3,4-thiadiazol-2-yl)cyclohexane-1-carboxamide is sourced from PubChem (CID 29369750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).