C20H23ClN2O3S — CID 29373732
N-[3-[(2-chlorophenyl)sulfamoyl]phenyl]-2-cyclohexylacetamide (PubChem CID 29373732) has the molecular formula C20H23ClN2O3S and a molecular weight of 406.94 g/mol. Its IUPAC name is N-[3-[(2-chlorophenyl)sulfamoyl]phenyl]-2-cyclohexylacetamide.
| Compound Name | N-[3-[(2-chlorophenyl)sulfamoyl]phenyl]-2-cyclohexylacetamide |
|---|---|
| PubChem CID | 29373732 |
| Molecular Formula | C20H23ClN2O3S |
| Molecular Weight | 406.94 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | N-[3-[(2-chlorophenyl)sulfamoyl]phenyl]-2-cyclohexylacetamide |
| SMILES | O=C(CC1CCCCC1)Nc1cccc(S(=O)(=O)Nc2ccccc2Cl)c1 |
| InChI | InChI=1S/C20H23ClN2O3S/c21-18-11-4-5-12-19(18)23-27(25,26)17-10-6-9-16(14-17)22-20(24)13-15-7-2-1-3-8-15/h4-6,9-12,14-15,23H,1-3,7-8,13H2,(H,22,24) |
| InChIKey | OZHFLEULBKRZKF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.94 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |