C26H31N3O5S — CID 29375917
(2S)-1-(3,4-dihydro-2H-quinolin-1-yl)-2-[[5-(3,4,5-triethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]propan-1-one (PubChem CID 29375917) has the molecular formula C26H31N3O5S and a molecular weight of 497.62 g/mol. Its IUPAC name is (2S)-1-(3,4-dihydro-2H-quinolin-1-yl)-2-[[5-(3,4,5-triethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]propan-1-one.
| Compound Name | (2S)-1-(3,4-dihydro-2H-quinolin-1-yl)-2-[[5-(3,4,5-triethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]propan-1-one |
|---|---|
| PubChem CID | 29375917 |
| Molecular Formula | C26H31N3O5S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | (2S)-1-(3,4-dihydro-2H-quinolin-1-yl)-2-[[5-(3,4,5-triethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]propan-1-one |
| SMILES | CCOc1cc(-c2nnc(S[C@@H](C)C(=O)N3CCCc4ccccc43)o2)cc(OCC)c1OCC |
| InChI | InChI=1S/C26H31N3O5S/c1-5-31-21-15-19(16-22(32-6-2)23(21)33-7-3)24-27-28-26(34-24)35-17(4)25(30)29-14-10-12-18-11-8-9-13-20(18)29/h8-9,11,13,15-17H,5-7,10,12,14H2,1-4H3/t17-/m0/s1 |
| InChIKey | DLRKRKKZUSBKIQ-KRWDZBQOSA-N |
| XLogP | 5.39 |
| TPSA | 86.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |