About 1,1,3-triethylurea
1,1,3-triethylurea (PubChem CID 29376) has the molecular formula C7H16N2O
and a molecular weight of 144.22 g/mol. Its IUPAC name is 1,1,3-triethylurea.
Molecular Properties
| Compound Name | 1,1,3-triethylurea |
| PubChem CID | 29376 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | 1,1,3-triethylurea |
| SMILES | CCNC(=O)N(CC)CC |
| InChI | InChI=1S/C7H16N2O/c1-4-8-7(10)9(5-2)6-3/h4-6H2,1-3H3,(H,8,10) |
| InChIKey | HJKYLTYAGGYRAZ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,1,3-triethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,3-triethylurea?
The IUPAC name of 1,1,3-triethylurea (CID 29376) is 1,1,3-triethylurea.
What is the SMILES notation for 1,1,3-triethylurea?
The canonical SMILES for 1,1,3-triethylurea is CCNC(=O)N(CC)CC.
What is the InChIKey of 1,1,3-triethylurea?
The InChIKey is HJKYLTYAGGYRAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O/c1-4-8-7(10)9(5-2)6-3/h4-6H2,1-3H3,(H,8,10).
What are the key properties of 1,1,3-triethylurea?
1,1,3-triethylurea has a molecular weight of 144.22 g/mol, XLogP of 1.06, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,3-triethylurea is sourced from PubChem (CID 29376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).