2-(1-cyclohexyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoic acid

C17H19NO4S — CID 2937638

IUPAC2-(1-cyclohexyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoic acid
SMILESO=C(O)c1ccccc1SC1CC(=O)N(C2CCCCC2)C1=O
InChIInChI=1S/C17H19NO4S/c19-15-10-14(16(20)18(15)11-6-2-1-3-7-11)23-13-9-5-4-8-12(13)17(21)22/h4-5,8-9,11,14H,1-3,6-7,10H2,(H,21,22)
InChIKeyQBPSYSBGRARKKS-UHFFFAOYSA-N
MW333.41 g/mol
LogP2.94
Rot. Bonds4

About 2-(1-cyclohexyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoic acid

2-(1-cyclohexyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoic acid (PubChem CID 2937638) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is 2-(1-cyclohexyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoic acid.

Molecular Properties

Compound Name2-(1-cyclohexyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoic acid
PubChem CID2937638
Molecular FormulaC17H19NO4S
Molecular Weight333.41 g/mol
Exact Mass333.10
IUPAC Name2-(1-cyclohexyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoic acid
SMILESO=C(O)c1ccccc1SC1CC(=O)N(C2CCCCC2)C1=O
InChIInChI=1S/C17H19NO4S/c19-15-10-14(16(20)18(15)11-6-2-1-3-7-11)23-13-9-5-4-8-12(13)17(21)22/h4-5,8-9,11,14H,1-3,6-7,10H2,(H,21,22)
InChIKeyQBPSYSBGRARKKS-UHFFFAOYSA-N
XLogP2.94
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500333.41
LogP ≤ 52.94
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 2-(1-cyclohexyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1-cyclohexyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoic acid?
The IUPAC name of 2-(1-cyclohexyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoic acid (CID 2937638) is 2-(1-cyclohexyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoic acid.
What is the SMILES notation for 2-(1-cyclohexyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoic acid?
The canonical SMILES for 2-(1-cyclohexyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoic acid is O=C(O)c1ccccc1SC1CC(=O)N(C2CCCCC2)C1=O.
What is the InChIKey of 2-(1-cyclohexyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoic acid?
The InChIKey is QBPSYSBGRARKKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO4S/c19-15-10-14(16(20)18(15)11-6-2-1-3-7-11)23-13-9-5-4-8-12(13)17(21)22/h4-5,8-9,11,14H,1-3,6-7,10H2,(H,21,22).
What are the key properties of 2-(1-cyclohexyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoic acid?
2-(1-cyclohexyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoic acid has a molecular weight of 333.41 g/mol, XLogP of 2.94, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-cyclohexyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoic acid is sourced from PubChem (CID 2937638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).