C20H25N7O3 — CID 2938024
4-N-ethyl-2-N,2-N-dimethyl-6-[6-[2-(2-methylphenoxy)ethoxy]pyridazin-3-yl]oxy-1,3,5-triazine-2,4-diamine (PubChem CID 2938024) has the molecular formula C20H25N7O3 and a molecular weight of 411.47 g/mol. Its IUPAC name is 4-N-ethyl-2-N,2-N-dimethyl-6-[6-[2-(2-methylphenoxy)ethoxy]pyridazin-3-yl]oxy-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-ethyl-2-N,2-N-dimethyl-6-[6-[2-(2-methylphenoxy)ethoxy]pyridazin-3-yl]oxy-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 2938024 |
| Molecular Formula | C20H25N7O3 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 4-N-ethyl-2-N,2-N-dimethyl-6-[6-[2-(2-methylphenoxy)ethoxy]pyridazin-3-yl]oxy-1,3,5-triazine-2,4-diamine |
| SMILES | CCNc1nc(Oc2ccc(OCCOc3ccccc3C)nn2)nc(N(C)C)n1 |
| InChI | InChI=1S/C20H25N7O3/c1-5-21-18-22-19(27(3)4)24-20(23-18)30-17-11-10-16(25-26-17)29-13-12-28-15-9-7-6-8-14(15)2/h6-11H,5,12-13H2,1-4H3,(H,21,22,23,24) |
| InChIKey | LIXSHVFBJACTOL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 107.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|