About 2-(4-benzyl-2,2-dimethyloxan-4-yl)-N-[(4-fluorophenyl)methyl]ethanamine
2-(4-benzyl-2,2-dimethyloxan-4-yl)-N-[(4-fluorophenyl)methyl]ethanamine (PubChem CID 2938065) has the molecular formula C23H30FNO
and a molecular weight of 355.50 g/mol. Its IUPAC name is 2-(4-benzyl-2,2-dimethyloxan-4-yl)-N-[(4-fluorophenyl)methyl]ethanamine.
Molecular Properties
| Compound Name | 2-(4-benzyl-2,2-dimethyloxan-4-yl)-N-[(4-fluorophenyl)methyl]ethanamine |
| PubChem CID | 2938065 |
| Molecular Formula | C23H30FNO |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 2-(4-benzyl-2,2-dimethyloxan-4-yl)-N-[(4-fluorophenyl)methyl]ethanamine |
| SMILES | CC1(C)CC(CCNCc2ccc(F)cc2)(Cc2ccccc2)CCO1 |
| InChI | InChI=1S/C23H30FNO/c1-22(2)18-23(13-15-26-22,16-19-6-4-3-5-7-19)12-14-25-17-20-8-10-21(24)11-9-20/h3-11,25H,12-18H2,1-2H3 |
| InChIKey | IZRHCTRCYUGXAD-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-benzyl-2,2-dimethyloxan-4-yl)-N-[(4-fluorophenyl)methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-benzyl-2,2-dimethyloxan-4-yl)-N-[(4-fluorophenyl)methyl]ethanamine?
The IUPAC name of 2-(4-benzyl-2,2-dimethyloxan-4-yl)-N-[(4-fluorophenyl)methyl]ethanamine (CID 2938065) is 2-(4-benzyl-2,2-dimethyloxan-4-yl)-N-[(4-fluorophenyl)methyl]ethanamine.
What is the SMILES notation for 2-(4-benzyl-2,2-dimethyloxan-4-yl)-N-[(4-fluorophenyl)methyl]ethanamine?
The canonical SMILES for 2-(4-benzyl-2,2-dimethyloxan-4-yl)-N-[(4-fluorophenyl)methyl]ethanamine is CC1(C)CC(CCNCc2ccc(F)cc2)(Cc2ccccc2)CCO1.
What is the InChIKey of 2-(4-benzyl-2,2-dimethyloxan-4-yl)-N-[(4-fluorophenyl)methyl]ethanamine?
The InChIKey is IZRHCTRCYUGXAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30FNO/c1-22(2)18-23(13-15-26-22,16-19-6-4-3-5-7-19)12-14-25-17-20-8-10-21(24)11-9-20/h3-11,25H,12-18H2,1-2H3.
What are the key properties of 2-(4-benzyl-2,2-dimethyloxan-4-yl)-N-[(4-fluorophenyl)methyl]ethanamine?
2-(4-benzyl-2,2-dimethyloxan-4-yl)-N-[(4-fluorophenyl)methyl]ethanamine has a molecular weight of 355.50 g/mol, XLogP of 5.12, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-benzyl-2,2-dimethyloxan-4-yl)-N-[(4-fluorophenyl)methyl]ethanamine is sourced from PubChem (CID 2938065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).