C25H22N6O4 — CID 29387354
[2-[2-[(4-methylphenyl)methylcarbamoyl]anilino]-2-oxoethyl] 4-(tetrazol-1-yl)benzoate (PubChem CID 29387354) has the molecular formula C25H22N6O4 and a molecular weight of 470.49 g/mol. Its IUPAC name is [2-[2-[(4-methylphenyl)methylcarbamoyl]anilino]-2-oxoethyl] 4-(tetrazol-1-yl)benzoate.
| Compound Name | [2-[2-[(4-methylphenyl)methylcarbamoyl]anilino]-2-oxoethyl] 4-(tetrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 29387354 |
| Molecular Formula | C25H22N6O4 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | [2-[2-[(4-methylphenyl)methylcarbamoyl]anilino]-2-oxoethyl] 4-(tetrazol-1-yl)benzoate |
| SMILES | Cc1ccc(CNC(=O)c2ccccc2NC(=O)COC(=O)c2ccc(-n3cnnn3)cc2)cc1 |
| InChI | InChI=1S/C25H22N6O4/c1-17-6-8-18(9-7-17)14-26-24(33)21-4-2-3-5-22(21)28-23(32)15-35-25(34)19-10-12-20(13-11-19)31-16-27-29-30-31/h2-13,16H,14-15H2,1H3,(H,26,33)(H,28,32) |
| InChIKey | DPRKJSOAWCHYIU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 128.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |