C15H21NO4S — CID 2938849
2-(2,3-dimethylphenoxy)-N-(1,1-dioxothiolan-3-yl)propanamide (PubChem CID 2938849) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is 2-(2,3-dimethylphenoxy)-N-(1,1-dioxothiolan-3-yl)propanamide.
| Compound Name | 2-(2,3-dimethylphenoxy)-N-(1,1-dioxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 2938849 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 2-(2,3-dimethylphenoxy)-N-(1,1-dioxothiolan-3-yl)propanamide |
| SMILES | Cc1cccc(OC(C)C(=O)NC2CCS(=O)(=O)C2)c1C |
| InChI | InChI=1S/C15H21NO4S/c1-10-5-4-6-14(11(10)2)20-12(3)15(17)16-13-7-8-21(18,19)9-13/h4-6,12-13H,7-9H2,1-3H3,(H,16,17) |
| InChIKey | VSOGLQDIFDCWJN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |