C17H16N2O7S2 — CID 29389236
[2-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)-2-oxoethyl] 5-nitrothiophene-2-carboxylate (PubChem CID 29389236) has the molecular formula C17H16N2O7S2 and a molecular weight of 424.46 g/mol. Its IUPAC name is [2-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)-2-oxoethyl] 5-nitrothiophene-2-carboxylate.
| Compound Name | [2-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)-2-oxoethyl] 5-nitrothiophene-2-carboxylate |
|---|---|
| PubChem CID | 29389236 |
| Molecular Formula | C17H16N2O7S2 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | [2-(1-methylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)-2-oxoethyl] 5-nitrothiophene-2-carboxylate |
| SMILES | CS(=O)(=O)N1CCCc2cc(C(=O)COC(=O)c3ccc([N+](=O)[O-])s3)ccc21 |
| InChI | InChI=1S/C17H16N2O7S2/c1-28(24,25)18-8-2-3-11-9-12(4-5-13(11)18)14(20)10-26-17(21)15-6-7-16(27-15)19(22)23/h4-7,9H,2-3,8,10H2,1H3 |
| InChIKey | UHECWPDGIYRSKX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|