About N-(1-adamantyl)benzamide
N-(1-adamantyl)benzamide (PubChem CID 29392) has the molecular formula C17H21NO
and a molecular weight of 255.36 g/mol. Its IUPAC name is N-(1-adamantyl)benzamide.
Molecular Properties
| Compound Name | N-(1-adamantyl)benzamide |
| PubChem CID | 29392 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | N-(1-adamantyl)benzamide |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)c1ccccc1 |
| InChI | InChI=1S/C17H21NO/c19-16(15-4-2-1-3-5-15)18-17-9-12-6-13(10-17)8-14(7-12)11-17/h1-5,12-14H,6-11H2,(H,18,19) |
| InChIKey | HIMFTDSGLWYLKA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(1-adamantyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-adamantyl)benzamide?
The IUPAC name of N-(1-adamantyl)benzamide (CID 29392) is N-(1-adamantyl)benzamide.
What is the SMILES notation for N-(1-adamantyl)benzamide?
The canonical SMILES for N-(1-adamantyl)benzamide is O=C(NC12CC3CC(CC(C3)C1)C2)c1ccccc1.
What is the InChIKey of N-(1-adamantyl)benzamide?
The InChIKey is HIMFTDSGLWYLKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO/c19-16(15-4-2-1-3-5-15)18-17-9-12-6-13(10-17)8-14(7-12)11-17/h1-5,12-14H,6-11H2,(H,18,19).
What are the key properties of N-(1-adamantyl)benzamide?
N-(1-adamantyl)benzamide has a molecular weight of 255.36 g/mol, XLogP of 3.39, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-adamantyl)benzamide is sourced from PubChem (CID 29392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).