About 1-[4-(1-adamantyl)phenyl]-6-hydroxy-5-methanimidoylpyrimidine-2,4-dione
1-[4-(1-adamantyl)phenyl]-6-hydroxy-5-methanimidoylpyrimidine-2,4-dione (PubChem CID 2939231) has the molecular formula C21H23N3O3
and a molecular weight of 365.43 g/mol. Its IUPAC name is 1-[4-(1-adamantyl)phenyl]-6-hydroxy-5-methanimidoylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-[4-(1-adamantyl)phenyl]-6-hydroxy-5-methanimidoylpyrimidine-2,4-dione |
| PubChem CID | 2939231 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 1-[4-(1-adamantyl)phenyl]-6-hydroxy-5-methanimidoylpyrimidine-2,4-dione |
| SMILES | [H]/N=C/c1c(O)n(-c2ccc(C34CC5CC(CC(C5)C3)C4)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H23N3O3/c22-11-17-18(25)23-20(27)24(19(17)26)16-3-1-15(2-4-16)21-8-12-5-13(9-21)7-14(6-12)10-21/h1-4,11-14,22,26H,5-10H2,(H,23,25,27)/b22-11+ |
| InChIKey | BYFNVBVTJXBIFO-SSDVNMTOSA-N |
| XLogP | 2.70 |
| TPSA | 98.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(1-adamantyl)phenyl]-6-hydroxy-5-methanimidoylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(1-adamantyl)phenyl]-6-hydroxy-5-methanimidoylpyrimidine-2,4-dione?
The IUPAC name of 1-[4-(1-adamantyl)phenyl]-6-hydroxy-5-methanimidoylpyrimidine-2,4-dione (CID 2939231) is 1-[4-(1-adamantyl)phenyl]-6-hydroxy-5-methanimidoylpyrimidine-2,4-dione.
What is the SMILES notation for 1-[4-(1-adamantyl)phenyl]-6-hydroxy-5-methanimidoylpyrimidine-2,4-dione?
The canonical SMILES for 1-[4-(1-adamantyl)phenyl]-6-hydroxy-5-methanimidoylpyrimidine-2,4-dione is [H]/N=C/c1c(O)n(-c2ccc(C34CC5CC(CC(C5)C3)C4)cc2)c(=O)[nH]c1=O.
What is the InChIKey of 1-[4-(1-adamantyl)phenyl]-6-hydroxy-5-methanimidoylpyrimidine-2,4-dione?
The InChIKey is BYFNVBVTJXBIFO-SSDVNMTOSA-N. The full InChI is InChI=1S/C21H23N3O3/c22-11-17-18(25)23-20(27)24(19(17)26)16-3-1-15(2-4-16)21-8-12-5-13(9-21)7-14(6-12)10-21/h1-4,11-14,22,26H,5-10H2,(H,23,25,27)/b22-11+.
What are the key properties of 1-[4-(1-adamantyl)phenyl]-6-hydroxy-5-methanimidoylpyrimidine-2,4-dione?
1-[4-(1-adamantyl)phenyl]-6-hydroxy-5-methanimidoylpyrimidine-2,4-dione has a molecular weight of 365.43 g/mol, XLogP of 2.70, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(1-adamantyl)phenyl]-6-hydroxy-5-methanimidoylpyrimidine-2,4-dione is sourced from PubChem (CID 2939231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).