About 4-(dipropylamino)-3,5-dinitrobenzenesulfonamide
4-(dipropylamino)-3,5-dinitrobenzenesulfonamide (PubChem CID 29393) has the molecular formula C12H18N4O6S
and a molecular weight of 346.37 g/mol. Its IUPAC name is 4-(dipropylamino)-3,5-dinitrobenzenesulfonamide.
Molecular Properties
| Compound Name | 4-(dipropylamino)-3,5-dinitrobenzenesulfonamide |
| PubChem CID | 29393 |
| Molecular Formula | C12H18N4O6S |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 4-(dipropylamino)-3,5-dinitrobenzenesulfonamide |
| SMILES | CCCN(CCC)c1c([N+](=O)[O-])cc(S(N)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H18N4O6S/c1-3-5-14(6-4-2)12-10(15(17)18)7-9(23(13,21)22)8-11(12)16(19)20/h7-8H,3-6H2,1-2H3,(H2,13,21,22) |
| InChIKey | UNAHYJYOSSSJHH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(dipropylamino)-3,5-dinitrobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dipropylamino)-3,5-dinitrobenzenesulfonamide?
The IUPAC name of 4-(dipropylamino)-3,5-dinitrobenzenesulfonamide (CID 29393) is 4-(dipropylamino)-3,5-dinitrobenzenesulfonamide.
What is the SMILES notation for 4-(dipropylamino)-3,5-dinitrobenzenesulfonamide?
The canonical SMILES for 4-(dipropylamino)-3,5-dinitrobenzenesulfonamide is CCCN(CCC)c1c([N+](=O)[O-])cc(S(N)(=O)=O)cc1[N+](=O)[O-].
What is the InChIKey of 4-(dipropylamino)-3,5-dinitrobenzenesulfonamide?
The InChIKey is UNAHYJYOSSSJHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4O6S/c1-3-5-14(6-4-2)12-10(15(17)18)7-9(23(13,21)22)8-11(12)16(19)20/h7-8H,3-6H2,1-2H3,(H2,13,21,22).
What are the key properties of 4-(dipropylamino)-3,5-dinitrobenzenesulfonamide?
4-(dipropylamino)-3,5-dinitrobenzenesulfonamide has a molecular weight of 346.37 g/mol, XLogP of 1.78, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dipropylamino)-3,5-dinitrobenzenesulfonamide is sourced from PubChem (CID 29393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).