About dipotassium;octyl phosphate
dipotassium;octyl phosphate (PubChem CID 29394) has the molecular formula C8H17K2O4P
and a molecular weight of 286.39 g/mol. Its IUPAC name is dipotassium;octyl phosphate.
Molecular Properties
| Compound Name | dipotassium;octyl phosphate |
| PubChem CID | 29394 |
| Molecular Formula | C8H17K2O4P |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | dipotassium;octyl phosphate |
| SMILES | CCCCCCCCOP(=O)([O-])[O-].[K+].[K+] |
| InChI | InChI=1S/C8H19O4P.2K/c1-2-3-4-5-6-7-8-12-13(9,10)11;;/h2-8H2,1H3,(H2,9,10,11);;/q;2*+1/p-2 |
| InChIKey | LPZZAIMVFFLHQU-UHFFFAOYSA-L |
| XLogP | -4.80 |
| TPSA | 72.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | -4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;octyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;octyl phosphate?
The IUPAC name of dipotassium;octyl phosphate (CID 29394) is dipotassium;octyl phosphate.
What is the SMILES notation for dipotassium;octyl phosphate?
The canonical SMILES for dipotassium;octyl phosphate is CCCCCCCCOP(=O)([O-])[O-].[K+].[K+].
What is the InChIKey of dipotassium;octyl phosphate?
The InChIKey is LPZZAIMVFFLHQU-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H19O4P.2K/c1-2-3-4-5-6-7-8-12-13(9,10)11;;/h2-8H2,1H3,(H2,9,10,11);;/q;2*+1/p-2.
What are the key properties of dipotassium;octyl phosphate?
dipotassium;octyl phosphate has a molecular weight of 286.39 g/mol, XLogP of -4.80, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;octyl phosphate is sourced from PubChem (CID 29394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).