About N-cyclohexyl-N-methyl-1,1-dioxothiolane-3-sulfonamide
N-cyclohexyl-N-methyl-1,1-dioxothiolane-3-sulfonamide (PubChem CID 2939428) has the molecular formula C11H21NO4S2
and a molecular weight of 295.43 g/mol. Its IUPAC name is N-cyclohexyl-N-methyl-1,1-dioxothiolane-3-sulfonamide.
Molecular Properties
| Compound Name | N-cyclohexyl-N-methyl-1,1-dioxothiolane-3-sulfonamide |
| PubChem CID | 2939428 |
| Molecular Formula | C11H21NO4S2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | N-cyclohexyl-N-methyl-1,1-dioxothiolane-3-sulfonamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H21NO4S2/c1-12(10-5-3-2-4-6-10)18(15,16)11-7-8-17(13,14)9-11/h10-11H,2-9H2,1H3 |
| InChIKey | YBLZTKIPHRZLLU-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclohexyl-N-methyl-1,1-dioxothiolane-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-N-methyl-1,1-dioxothiolane-3-sulfonamide?
The IUPAC name of N-cyclohexyl-N-methyl-1,1-dioxothiolane-3-sulfonamide (CID 2939428) is N-cyclohexyl-N-methyl-1,1-dioxothiolane-3-sulfonamide.
What is the SMILES notation for N-cyclohexyl-N-methyl-1,1-dioxothiolane-3-sulfonamide?
The canonical SMILES for N-cyclohexyl-N-methyl-1,1-dioxothiolane-3-sulfonamide is CN(C1CCCCC1)S(=O)(=O)C1CCS(=O)(=O)C1.
What is the InChIKey of N-cyclohexyl-N-methyl-1,1-dioxothiolane-3-sulfonamide?
The InChIKey is YBLZTKIPHRZLLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO4S2/c1-12(10-5-3-2-4-6-10)18(15,16)11-7-8-17(13,14)9-11/h10-11H,2-9H2,1H3.
What are the key properties of N-cyclohexyl-N-methyl-1,1-dioxothiolane-3-sulfonamide?
N-cyclohexyl-N-methyl-1,1-dioxothiolane-3-sulfonamide has a molecular weight of 295.43 g/mol, XLogP of 0.77, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-N-methyl-1,1-dioxothiolane-3-sulfonamide is sourced from PubChem (CID 2939428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).