C19H25NO6 — CID 29395277
[(2R)-1-morpholin-4-yl-1-oxopropan-2-yl] 2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]acetate (PubChem CID 29395277) has the molecular formula C19H25NO6 and a molecular weight of 363.41 g/mol. Its IUPAC name is [(2R)-1-morpholin-4-yl-1-oxopropan-2-yl] 2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]acetate.
| Compound Name | [(2R)-1-morpholin-4-yl-1-oxopropan-2-yl] 2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]acetate |
|---|---|
| PubChem CID | 29395277 |
| Molecular Formula | C19H25NO6 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | [(2R)-1-morpholin-4-yl-1-oxopropan-2-yl] 2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]acetate |
| SMILES | C/C=C/c1ccc(OCC(=O)O[C@H](C)C(=O)N2CCOCC2)c(OC)c1 |
| InChI | InChI=1S/C19H25NO6/c1-4-5-15-6-7-16(17(12-15)23-3)25-13-18(21)26-14(2)19(22)20-8-10-24-11-9-20/h4-7,12,14H,8-11,13H2,1-3H3/b5-4+/t14-/m1/s1 |
| InChIKey | LGBHMGPQXHUMTK-ISZGNANSSA-N |
| XLogP | 1.90 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |