C18H17NO4 — CID 2939714
prop-2-enyl 3-(furan-2-yl)-2-[(4-methylbenzoyl)amino]prop-2-enoate (PubChem CID 2939714) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is prop-2-enyl 3-(furan-2-yl)-2-[(4-methylbenzoyl)amino]prop-2-enoate.
| Compound Name | prop-2-enyl 3-(furan-2-yl)-2-[(4-methylbenzoyl)amino]prop-2-enoate |
|---|---|
| PubChem CID | 2939714 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | prop-2-enyl 3-(furan-2-yl)-2-[(4-methylbenzoyl)amino]prop-2-enoate |
| SMILES | C=CCOC(=O)C(=Cc1ccco1)NC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H17NO4/c1-3-10-23-18(21)16(12-15-5-4-11-22-15)19-17(20)14-8-6-13(2)7-9-14/h3-9,11-12H,1,10H2,2H3,(H,19,20) |
| InChIKey | PEEJARFHMGBUSL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|