C20H21ClN2OS2 — CID 2940006
N-(1-adamantylcarbamothioyl)-3-chloro-1-benzothiophene-2-carboxamide (PubChem CID 2940006) has the molecular formula C20H21ClN2OS2 and a molecular weight of 404.99 g/mol. Its IUPAC name is N-(1-adamantylcarbamothioyl)-3-chloro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(1-adamantylcarbamothioyl)-3-chloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 2940006 |
| Molecular Formula | C20H21ClN2OS2 |
| Molecular Weight | 404.99 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | N-(1-adamantylcarbamothioyl)-3-chloro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NC(=S)NC12CC3CC(CC(C3)C1)C2)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C20H21ClN2OS2/c21-16-14-3-1-2-4-15(14)26-17(16)18(24)22-19(25)23-20-8-11-5-12(9-20)7-13(6-11)10-20/h1-4,11-13H,5-10H2,(H2,22,23,24,25) |
| InChIKey | WFDSBFYBWADRAD-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.99 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|