About 4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undecane
4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undecane (PubChem CID 29408) has the molecular formula C15H26
and a molecular weight of 206.37 g/mol. Its IUPAC name is 4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undecane.
Analyze 4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undecane?
The IUPAC name of 4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undecane (CID 29408) is 4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undecane.
What is the SMILES notation for 4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undecane?
The canonical SMILES for 4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undecane is CC1CCC23C(C)CCC(CC12)C3(C)C.
What is the InChIKey of 4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undecane?
The InChIKey is MVZZUMCHPFHUOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26/c1-10-7-8-15-11(2)5-6-12(9-13(10)15)14(15,3)4/h10-13H,5-9H2,1-4H3.
What are the key properties of 4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undecane?
4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undecane has a molecular weight of 206.37 g/mol, XLogP of 4.49, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,10,11,11-tetramethyltricyclo[5.3.1.01,5]undecane is sourced from PubChem (CID 29408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).