C15H16N4OS — CID 29410765
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-indol-1-ylpropanamide (PubChem CID 29410765) has the molecular formula C15H16N4OS and a molecular weight of 300.39 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-indol-1-ylpropanamide.
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-indol-1-ylpropanamide |
|---|---|
| PubChem CID | 29410765 |
| Molecular Formula | C15H16N4OS |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-indol-1-ylpropanamide |
| SMILES | CCc1nnc(NC(=O)CCn2ccc3ccccc32)s1 |
| InChI | InChI=1S/C15H16N4OS/c1-2-14-17-18-15(21-14)16-13(20)8-10-19-9-7-11-5-3-4-6-12(11)19/h3-7,9H,2,8,10H2,1H3,(H,16,18,20) |
| InChIKey | AOHFGTRNZUTPCU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |