About [[amino-(3-methylphenyl)methylidene]amino] morpholine-4-carboxylate
[[amino-(3-methylphenyl)methylidene]amino] morpholine-4-carboxylate (PubChem CID 2941203) has the molecular formula C13H17N3O3
and a molecular weight of 263.30 g/mol. Its IUPAC name is [[amino-(3-methylphenyl)methylidene]amino] morpholine-4-carboxylate.
Molecular Properties
| Compound Name | [[amino-(3-methylphenyl)methylidene]amino] morpholine-4-carboxylate |
| PubChem CID | 2941203 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | [[amino-(3-methylphenyl)methylidene]amino] morpholine-4-carboxylate |
| SMILES | Cc1cccc(C(N)=NOC(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C13H17N3O3/c1-10-3-2-4-11(9-10)12(14)15-19-13(17)16-5-7-18-8-6-16/h2-4,9H,5-8H2,1H3,(H2,14,15) |
| InChIKey | ZLSARIVSSBFFOK-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[amino-(3-methylphenyl)methylidene]amino] morpholine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[amino-(3-methylphenyl)methylidene]amino] morpholine-4-carboxylate?
The IUPAC name of [[amino-(3-methylphenyl)methylidene]amino] morpholine-4-carboxylate (CID 2941203) is [[amino-(3-methylphenyl)methylidene]amino] morpholine-4-carboxylate.
What is the SMILES notation for [[amino-(3-methylphenyl)methylidene]amino] morpholine-4-carboxylate?
The canonical SMILES for [[amino-(3-methylphenyl)methylidene]amino] morpholine-4-carboxylate is Cc1cccc(C(N)=NOC(=O)N2CCOCC2)c1.
What is the InChIKey of [[amino-(3-methylphenyl)methylidene]amino] morpholine-4-carboxylate?
The InChIKey is ZLSARIVSSBFFOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O3/c1-10-3-2-4-11(9-10)12(14)15-19-13(17)16-5-7-18-8-6-16/h2-4,9H,5-8H2,1H3,(H2,14,15).
What are the key properties of [[amino-(3-methylphenyl)methylidene]amino] morpholine-4-carboxylate?
[[amino-(3-methylphenyl)methylidene]amino] morpholine-4-carboxylate has a molecular weight of 263.30 g/mol, XLogP of 1.08, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [[amino-(3-methylphenyl)methylidene]amino] morpholine-4-carboxylate is sourced from PubChem (CID 2941203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).