C28H31NO4 — CID 2941219
(4-tert-butylphenyl) 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-3-phenylpropanoate (PubChem CID 2941219) has the molecular formula C28H31NO4 and a molecular weight of 445.56 g/mol. Its IUPAC name is (4-tert-butylphenyl) 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-3-phenylpropanoate.
| Compound Name | (4-tert-butylphenyl) 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 2941219 |
| Molecular Formula | C28H31NO4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | (4-tert-butylphenyl) 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-3-phenylpropanoate |
| SMILES | CC(C)(C)c1ccc(OC(=O)C(Cc2ccccc2)N2C(=O)C3C4CCC(C4)C3C2=O)cc1 |
| InChI | InChI=1S/C28H31NO4/c1-28(2,3)20-11-13-21(14-12-20)33-27(32)22(15-17-7-5-4-6-8-17)29-25(30)23-18-9-10-19(16-18)24(23)26(29)31/h4-8,11-14,18-19,22-24H,9-10,15-16H2,1-3H3 |
| InChIKey | RERBILWPBDDPLO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|