C17H21N3OS2 — CID 29412625
N-(5-ethyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 29412625) has the molecular formula C17H21N3OS2 and a molecular weight of 347.51 g/mol. Its IUPAC name is N-(5-ethyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-(5-ethyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 29412625 |
| Molecular Formula | C17H21N3OS2 |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | N-(5-ethyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CCN1CCc2nc(NC(=O)c3csc4c3CCCC4)sc2C1 |
| InChI | InChI=1S/C17H21N3OS2/c1-2-20-8-7-13-15(9-20)23-17(18-13)19-16(21)12-10-22-14-6-4-3-5-11(12)14/h10H,2-9H2,1H3,(H,18,19,21) |
| InChIKey | KZIUWDALXSRQHI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |