C12H8BrN3O4 — CID 2941339
6-[2-(4-bromophenyl)ethenyl]-5-nitro-1H-pyrimidine-2,4-dione (PubChem CID 2941339) has the molecular formula C12H8BrN3O4 and a molecular weight of 338.12 g/mol. Its IUPAC name is 6-[2-(4-bromophenyl)ethenyl]-5-nitro-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[2-(4-bromophenyl)ethenyl]-5-nitro-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2941339 |
| Molecular Formula | C12H8BrN3O4 |
| Molecular Weight | 338.12 g/mol |
| Exact Mass | 336.97 |
| IUPAC Name | 6-[2-(4-bromophenyl)ethenyl]-5-nitro-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(C=Cc2ccc(Br)cc2)c([N+](=O)[O-])c(=O)[nH]1 |
| InChI | InChI=1S/C12H8BrN3O4/c13-8-4-1-7(2-5-8)3-6-9-10(16(19)20)11(17)15-12(18)14-9/h1-6H,(H2,14,15,17,18) |
| InChIKey | FLYDOPKYLNIQNZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 108.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.12 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|