About 1-(4-methoxyphenyl)-N,N-dipropylpyrazolo[5,4-d]pyrimidin-4-amine
1-(4-methoxyphenyl)-N,N-dipropylpyrazolo[5,4-d]pyrimidin-4-amine (PubChem CID 2941340) has the molecular formula C18H23N5O
and a molecular weight of 325.42 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-N,N-dipropylpyrazolo[5,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 1-(4-methoxyphenyl)-N,N-dipropylpyrazolo[5,4-d]pyrimidin-4-amine |
| PubChem CID | 2941340 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 1-(4-methoxyphenyl)-N,N-dipropylpyrazolo[5,4-d]pyrimidin-4-amine |
| SMILES | CCCN(CCC)c1ncnc2c1cnn2-c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H23N5O/c1-4-10-22(11-5-2)17-16-12-21-23(18(16)20-13-19-17)14-6-8-15(24-3)9-7-14/h6-9,12-13H,4-5,10-11H2,1-3H3 |
| InChIKey | HIHZFTNEEQAKJI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(4-methoxyphenyl)-N,N-dipropylpyrazolo[5,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methoxyphenyl)-N,N-dipropylpyrazolo[5,4-d]pyrimidin-4-amine?
The IUPAC name of 1-(4-methoxyphenyl)-N,N-dipropylpyrazolo[5,4-d]pyrimidin-4-amine (CID 2941340) is 1-(4-methoxyphenyl)-N,N-dipropylpyrazolo[5,4-d]pyrimidin-4-amine.
What is the SMILES notation for 1-(4-methoxyphenyl)-N,N-dipropylpyrazolo[5,4-d]pyrimidin-4-amine?
The canonical SMILES for 1-(4-methoxyphenyl)-N,N-dipropylpyrazolo[5,4-d]pyrimidin-4-amine is CCCN(CCC)c1ncnc2c1cnn2-c1ccc(OC)cc1.
What is the InChIKey of 1-(4-methoxyphenyl)-N,N-dipropylpyrazolo[5,4-d]pyrimidin-4-amine?
The InChIKey is HIHZFTNEEQAKJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N5O/c1-4-10-22(11-5-2)17-16-12-21-23(18(16)20-13-19-17)14-6-8-15(24-3)9-7-14/h6-9,12-13H,4-5,10-11H2,1-3H3.
What are the key properties of 1-(4-methoxyphenyl)-N,N-dipropylpyrazolo[5,4-d]pyrimidin-4-amine?
1-(4-methoxyphenyl)-N,N-dipropylpyrazolo[5,4-d]pyrimidin-4-amine has a molecular weight of 325.42 g/mol, XLogP of 3.45, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methoxyphenyl)-N,N-dipropylpyrazolo[5,4-d]pyrimidin-4-amine is sourced from PubChem (CID 2941340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).