C19H18N2O3 — CID 2941363
[2-(2-acetyl-3-phenyl-3,4-dihydropyrazol-5-yl)phenyl] acetate (PubChem CID 2941363) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is [2-(2-acetyl-3-phenyl-3,4-dihydropyrazol-5-yl)phenyl] acetate.
| Compound Name | [2-(2-acetyl-3-phenyl-3,4-dihydropyrazol-5-yl)phenyl] acetate |
|---|---|
| PubChem CID | 2941363 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | [2-(2-acetyl-3-phenyl-3,4-dihydropyrazol-5-yl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C1=NN(C(C)=O)C(c2ccccc2)C1 |
| InChI | InChI=1S/C19H18N2O3/c1-13(22)21-18(15-8-4-3-5-9-15)12-17(20-21)16-10-6-7-11-19(16)24-14(2)23/h3-11,18H,12H2,1-2H3 |
| InChIKey | BRWUUAPBLHJNPA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|