C16H19F4NO3 — CID 2941650
N-(oxolan-2-ylmethyl)-4-(2,2,3,3-tetrafluoropropoxymethyl)benzamide (PubChem CID 2941650) has the molecular formula C16H19F4NO3 and a molecular weight of 349.32 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-4-(2,2,3,3-tetrafluoropropoxymethyl)benzamide.
| Compound Name | N-(oxolan-2-ylmethyl)-4-(2,2,3,3-tetrafluoropropoxymethyl)benzamide |
|---|---|
| PubChem CID | 2941650 |
| Molecular Formula | C16H19F4NO3 |
| Molecular Weight | 349.32 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-4-(2,2,3,3-tetrafluoropropoxymethyl)benzamide |
| SMILES | O=C(NCC1CCCO1)c1ccc(COCC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C16H19F4NO3/c17-15(18)16(19,20)10-23-9-11-3-5-12(6-4-11)14(22)21-8-13-2-1-7-24-13/h3-6,13,15H,1-2,7-10H2,(H,21,22) |
| InChIKey | NWELHOQLZPPZGR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|