C15H17N5O4 — CID 29416681
3-amino-N'-[2-(2-ethoxyphenoxy)acetyl]pyrazine-2-carbohydrazide (PubChem CID 29416681) has the molecular formula C15H17N5O4 and a molecular weight of 331.33 g/mol. Its IUPAC name is 3-amino-N'-[2-(2-ethoxyphenoxy)acetyl]pyrazine-2-carbohydrazide.
| Compound Name | 3-amino-N'-[2-(2-ethoxyphenoxy)acetyl]pyrazine-2-carbohydrazide |
|---|---|
| PubChem CID | 29416681 |
| Molecular Formula | C15H17N5O4 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 3-amino-N'-[2-(2-ethoxyphenoxy)acetyl]pyrazine-2-carbohydrazide |
| SMILES | CCOc1ccccc1OCC(=O)NNC(=O)c1nccnc1N |
| InChI | InChI=1S/C15H17N5O4/c1-2-23-10-5-3-4-6-11(10)24-9-12(21)19-20-15(22)13-14(16)18-8-7-17-13/h3-8H,2,9H2,1H3,(H2,16,18)(H,19,21)(H,20,22) |
| InChIKey | RSTGFVKNCYIKSW-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 128.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|