C18H15F3N2O2S2 — CID 2941826
5,5-dioxo-1-phenyl-3-[3-(trifluoromethyl)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole-2-thione (PubChem CID 2941826) has the molecular formula C18H15F3N2O2S2 and a molecular weight of 412.46 g/mol. Its IUPAC name is 5,5-dioxo-1-phenyl-3-[3-(trifluoromethyl)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole-2-thione.
| Compound Name | 5,5-dioxo-1-phenyl-3-[3-(trifluoromethyl)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole-2-thione |
|---|---|
| PubChem CID | 2941826 |
| Molecular Formula | C18H15F3N2O2S2 |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | 5,5-dioxo-1-phenyl-3-[3-(trifluoromethyl)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazole-2-thione |
| SMILES | O=S1(=O)CC2C(C1)N(c1cccc(C(F)(F)F)c1)C(=S)N2c1ccccc1 |
| InChI | InChI=1S/C18H15F3N2O2S2/c19-18(20,21)12-5-4-8-14(9-12)23-16-11-27(24,25)10-15(16)22(17(23)26)13-6-2-1-3-7-13/h1-9,15-16H,10-11H2 |
| InChIKey | NXWDVNVQVUEOOZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|