About 2-ethoxypropan-1-ol
2-ethoxypropan-1-ol (PubChem CID 29420) has the molecular formula C5H12O2
and a molecular weight of 104.15 g/mol. Its IUPAC name is 2-ethoxypropan-1-ol.
Molecular Properties
| Compound Name | 2-ethoxypropan-1-ol |
| PubChem CID | 29420 |
| Molecular Formula | C5H12O2 |
| Molecular Weight | 104.15 g/mol |
| Exact Mass | 104.08 |
| IUPAC Name | 2-ethoxypropan-1-ol |
| SMILES | CCOC(C)CO |
| InChI | InChI=1S/C5H12O2/c1-3-7-5(2)4-6/h5-6H,3-4H2,1-2H3 |
| InChIKey | DEDUBNVYPMOFDR-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.15 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethoxypropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxypropan-1-ol?
The IUPAC name of 2-ethoxypropan-1-ol (CID 29420) is 2-ethoxypropan-1-ol.
What is the SMILES notation for 2-ethoxypropan-1-ol?
The canonical SMILES for 2-ethoxypropan-1-ol is CCOC(C)CO.
What is the InChIKey of 2-ethoxypropan-1-ol?
The InChIKey is DEDUBNVYPMOFDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O2/c1-3-7-5(2)4-6/h5-6H,3-4H2,1-2H3.
What are the key properties of 2-ethoxypropan-1-ol?
2-ethoxypropan-1-ol has a molecular weight of 104.15 g/mol, XLogP of 0.40, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxypropan-1-ol is sourced from PubChem (CID 29420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).