C14H20N2O — CID 2942390
N-tert-butyl-3,4-dihydro-1H-isoquinoline-2-carboxamide (PubChem CID 2942390) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is N-tert-butyl-3,4-dihydro-1H-isoquinoline-2-carboxamide.
| Compound Name | N-tert-butyl-3,4-dihydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 2942390 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | N-tert-butyl-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| SMILES | CC(C)(C)NC(=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C14H20N2O/c1-14(2,3)15-13(17)16-9-8-11-6-4-5-7-12(11)10-16/h4-7H,8-10H2,1-3H3,(H,15,17) |
| InChIKey | QFVXUFDJYHLUBA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |