C19H18F4N2O2 — CID 29427521
2,3,4,5-tetrafluoro-N-methyl-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]benzamide (PubChem CID 29427521) has the molecular formula C19H18F4N2O2 and a molecular weight of 382.36 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-N-methyl-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]benzamide.
| Compound Name | 2,3,4,5-tetrafluoro-N-methyl-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 29427521 |
| Molecular Formula | C19H18F4N2O2 |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 2,3,4,5-tetrafluoro-N-methyl-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]benzamide |
| SMILES | Cc1cc(C)c(NC(=O)CN(C)C(=O)c2cc(F)c(F)c(F)c2F)c(C)c1 |
| InChI | InChI=1S/C19H18F4N2O2/c1-9-5-10(2)18(11(3)6-9)24-14(26)8-25(4)19(27)12-7-13(20)16(22)17(23)15(12)21/h5-7H,8H2,1-4H3,(H,24,26) |
| InChIKey | KWYIRAJPOJWDJL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|