C13H7Cl2N5O2S — CID 2942776
2-[[5-(2,4-dichlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-5-nitropyridine (PubChem CID 2942776) has the molecular formula C13H7Cl2N5O2S and a molecular weight of 368.21 g/mol. Its IUPAC name is 2-[[5-(2,4-dichlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-5-nitropyridine.
| Compound Name | 2-[[5-(2,4-dichlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-5-nitropyridine |
|---|---|
| PubChem CID | 2942776 |
| Molecular Formula | C13H7Cl2N5O2S |
| Molecular Weight | 368.21 g/mol |
| Exact Mass | 366.97 |
| IUPAC Name | 2-[[5-(2,4-dichlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-5-nitropyridine |
| SMILES | O=[N+]([O-])c1ccc(Sc2n[nH]c(-c3ccc(Cl)cc3Cl)n2)nc1 |
| InChI | InChI=1S/C13H7Cl2N5O2S/c14-7-1-3-9(10(15)5-7)12-17-13(19-18-12)23-11-4-2-8(6-16-11)20(21)22/h1-6H,(H,17,18,19) |
| InChIKey | AMSWOBPTAGXMHB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.21 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|